Compound Q&A

What precautions should be taken when handling 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

Answer

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
Proper handling of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine requires the use of personal protective equipment (PPE) including gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be cleaned up with appropriate absorbent materials, and the area should be thoroughly washed down. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
Molecular Formula C13H11Cl2FN2O
Molecular Weight 301.15 g/mol
SMILES C[C@H](c1c(ccc(c1Cl)F)Cl)Oc2cccnc2N
InChIKey IEKMAKBQCRKWLS-SSDOTTSWSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is a crystalline compound with a mole...

Compound Q&A

How is 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2) typically synthesized?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine can be synthesized via a multi-step p...

Compound Q&A

What industries use 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is primarily used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...