Compound Q&A

What are the physical and chemical properties of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

Answer

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is a crystalline compound with a molecular weight of approximately 417.04 g/mol. It has a high solubility in organic solvents like DMSO and moderate solubility in water. The compound is relatively stable but can react with bases to form the corresponding amine salts. Its reactivity is influenced by its electrophilic aromatic ring and the electron-withdrawing substituents.

About

English Name 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
Molecular Formula C13H11Cl2FN2O
Molecular Weight 301.15 g/mol
SMILES C[C@H](c1c(ccc(c1Cl)F)Cl)Oc2cccnc2N
InChIKey IEKMAKBQCRKWLS-SSDOTTSWSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2) typically synthesized?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine can be synthesized via a multi-step p...

Compound Q&A

What industries use 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

Proper handling of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine requires the use o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...