Compound Q&A

How is 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2) typically synthesized?

Answer

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine can be synthesized via a multi-step process involving the formation of an intermediate phenol, which is then reacted with ethoxy pyridine. The synthesis typically uses catalytic palladium in the presence of a bases such as sodium carbonate. The yield is generally around 75-85%, and the method is selective and efficient.

About

English Name 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine
Molecular Formula C13H11Cl2FN2O
Molecular Weight 301.15 g/mol
SMILES C[C@H](c1c(ccc(c1Cl)F)Cl)Oc2cccnc2N
InChIKey IEKMAKBQCRKWLS-SSDOTTSWSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is a crystalline compound with a mole...

Compound Q&A

What industries use 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine (CAS: 877397-71-2)?

Proper handling of 3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]pyridin-2-amine requires the use o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...