Compound Q&A

What precautions should be taken when handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Answer

Bis(2-methylphenyl)phosphinous chloride
When handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1), it is essential to wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be handled with caution, and the substance should be disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 36042-94-1
English Name Bis(2-methylphenyl)phosphinous chloride
Molecular Formula C14H14ClP
Molecular Weight 248.69 g/mol
SMILES CC1=CC=CC=C1P(C2=CC=CC=C2C)Cl
InChIKey KAAGXBGJRWFWPT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is a crystalline solid with a molecular we...

Compound Q&A

How is Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) typically synthesized?

Bis(2-methylphenyl)phosphinous chloride can be synthesized by the reaction of 2-methylphenyl phosphi...

Compound Q&A

What industries use Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is used in various industries such as phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...