Compound Q&A

What industries use Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Answer

Bis(2-methylphenyl)phosphinous chloride
Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is used in various industries such as pharmaceuticals for the synthesis of certain intermediates, polymers for functionalization and modification, and sensors for detecting specific gases. Its reactivity and unique chemical properties make it valuable in semiconductor applications as well.

About

CAS No 36042-94-1
English Name Bis(2-methylphenyl)phosphinous chloride
Molecular Formula C14H14ClP
Molecular Weight 248.69 g/mol
SMILES CC1=CC=CC=C1P(C2=CC=CC=C2C)Cl
InChIKey KAAGXBGJRWFWPT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is a crystalline solid with a molecular we...

Compound Q&A

How is Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) typically synthesized?

Bis(2-methylphenyl)phosphinous chloride can be synthesized by the reaction of 2-methylphenyl phosphi...

Compound Q&A

What precautions should be taken when handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

When handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1), it is essential to wear per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...