Compound Q&A

What are the physical and chemical properties of Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Answer

Bis(2-methylphenyl)phosphinous chloride
Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is a crystalline solid with a molecular weight of approximately 270.27 g/mol. It is poorly soluble in water but has good solubility in organic solvents like dichloromethane and chloroform. The compound is reactive towards moisture and is prone to hydrolysis, making it important to handle under an inert atmosphere to prevent decomposition.

About

CAS No 36042-94-1
English Name Bis(2-methylphenyl)phosphinous chloride
Molecular Formula C14H14ClP
Molecular Weight 248.69 g/mol
SMILES CC1=CC=CC=C1P(C2=CC=CC=C2C)Cl
InChIKey KAAGXBGJRWFWPT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) typically synthesized?

Bis(2-methylphenyl)phosphinous chloride can be synthesized by the reaction of 2-methylphenyl phosphi...

Compound Q&A

What industries use Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is used in various industries such as phar...

Compound Q&A

What precautions should be taken when handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

When handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1), it is essential to wear per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...