Compound Q&A

How is Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) typically synthesized?

Answer

Bis(2-methylphenyl)phosphinous chloride
Bis(2-methylphenyl)phosphinous chloride can be synthesized by the reaction of 2-methylphenyl phosphine with hydrogen chloride. The reaction is typically carried out under an inert atmosphere to prevent the formation of undesired by-products. The yield and purity of the product can be optimized by using appropriate catalysts and conditions.

About

CAS No 36042-94-1
English Name Bis(2-methylphenyl)phosphinous chloride
Molecular Formula C14H14ClP
Molecular Weight 248.69 g/mol
SMILES CC1=CC=CC=C1P(C2=CC=CC=C2C)Cl
InChIKey KAAGXBGJRWFWPT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is a crystalline solid with a molecular we...

Compound Q&A

What industries use Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1) is used in various industries such as phar...

Compound Q&A

What precautions should be taken when handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1)?

When handling Bis(2-methylphenyl)phosphinous chloride (CAS: 36042-94-1), it is essential to wear per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...