Compound Q&A

How should waste containing Ganoderenic acid B (CAS: 100665-41-6) be handled?

Answer

Ganoderenic acid B
Waste containing Ganoderenic acid B (CAS: 100665-41-6) should be handled with care. Collection should be done in an appropriate container and stored in a safe, well-ventilated area. For disposal, consider professional waste disposal services to ensure it is incinerated or treated in an environmentally friendly manner. Safety precautions include wearing protective gear and following local environmental protection regulations to minimize environmental impact.

About

English Name Ganoderenic acid B
Molecular Formula C30H42O7
Molecular Weight 514.66 g/mol
SMILES CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O
InChIKey QECQJYAIIIIKJB-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ganoderenic acid B (CAS: 100665-41-6)?

Ganoderenic acid B (CAS: 100665-41-6) is subject to various regulatory guidelines. Its safety and ha...

Compound Q&A

Are there alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis?

Yes, there are alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis. Common alternativ...

Compound Q&A

What is the market or research trend for Ganoderenic acid B (CAS: 100665-41-6)?

The market trend for Ganoderenic acid B (CAS: 100665-41-6) is growing due to its potential health be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...