Compound Q&A

Are there alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis?

Answer

Ganoderenic acid B
Yes, there are alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis. Common alternatives include other triterpenoids and their isomers, such as ganoderic acid A and ganoderic acid C. Alternative reagents like saponins and other natural compounds can also be used. These alternatives can provide similar biological activities and can be sourced from various natural products or synthesized using different chemical methods.

About

English Name Ganoderenic acid B
Molecular Formula C30H42O7
Molecular Weight 514.66 g/mol
SMILES CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O
InChIKey QECQJYAIIIIKJB-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ganoderenic acid B (CAS: 100665-41-6)?

Ganoderenic acid B (CAS: 100665-41-6) is subject to various regulatory guidelines. Its safety and ha...

Compound Q&A

What is the market or research trend for Ganoderenic acid B (CAS: 100665-41-6)?

The market trend for Ganoderenic acid B (CAS: 100665-41-6) is growing due to its potential health be...

Compound Q&A

How should waste containing Ganoderenic acid B (CAS: 100665-41-6) be handled?

Waste containing Ganoderenic acid B (CAS: 100665-41-6) should be handled with care. Collection shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...