Compound Q&A

What is the market or research trend for Ganoderenic acid B (CAS: 100665-41-6)?

Answer

Ganoderenic acid B
The market trend for Ganoderenic acid B (CAS: 100665-41-6) is growing due to its potential health benefits, such as anti-inflammatory and antioxidant properties. Research is increasingly focusing on its therapeutic applications in cancer, cardiovascular diseases, and immune modulation. The demand is likely to increase as more studies validate its effectiveness and safety, leading to its potential inclusion in pharmaceutical and nutraceutical products.

About

English Name Ganoderenic acid B
Molecular Formula C30H42O7
Molecular Weight 514.66 g/mol
SMILES CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O
InChIKey QECQJYAIIIIKJB-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ganoderenic acid B (CAS: 100665-41-6)?

Ganoderenic acid B (CAS: 100665-41-6) is subject to various regulatory guidelines. Its safety and ha...

Compound Q&A

Are there alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis?

Yes, there are alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis. Common alternativ...

Compound Q&A

How should waste containing Ganoderenic acid B (CAS: 100665-41-6) be handled?

Waste containing Ganoderenic acid B (CAS: 100665-41-6) should be handled with care. Collection shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...