Compound Q&A

What regulatory guidelines apply to Ganoderenic acid B (CAS: 100665-41-6)?

Answer

Ganoderenic acid B
Ganoderenic acid B (CAS: 100665-41-6) is subject to various regulatory guidelines. Its safety and handling are regulated under the Globally Harmonized System of Classification and Labelling of Chemicals (GHS), Integrated Environmental Management (IEM), and REACH regulations in the European Union. In the United States, it is also regulated by the FDA for purity standards and EPA for environmental protection. Companies should comply with these guidelines to ensure safe handling and use.

About

English Name Ganoderenic acid B
Molecular Formula C30H42O7
Molecular Weight 514.66 g/mol
SMILES CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O
InChIKey QECQJYAIIIIKJB-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

Are there alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis?

Yes, there are alternatives to Ganoderenic acid B (CAS: 100665-41-6) in synthesis. Common alternativ...

Compound Q&A

What is the market or research trend for Ganoderenic acid B (CAS: 100665-41-6)?

The market trend for Ganoderenic acid B (CAS: 100665-41-6) is growing due to its potential health be...

Compound Q&A

How should waste containing Ganoderenic acid B (CAS: 100665-41-6) be handled?

Waste containing Ganoderenic acid B (CAS: 100665-41-6) should be handled with care. Collection shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...