Compound Q&A

What precautions should be taken when handling (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

Answer

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid
When handling (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 23979-41-1
English Name (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O
InChIKey CMWTZPSULFXXJA-SECBINFHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is a solid with a crystalline form. Its molecular weight...

Compound Q&A

How is (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1) typically synthesized?

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is typically synthesized via a multi-step process involv...

Compound Q&A

What industries use (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...