Compound Q&A

What industries use (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

Answer

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid
(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds application in the production of organic semiconductors and as a precursor in the development of novel materials for sensors and polymers. Its unique chemical properties make it valuable in these sectors.

About

CAS No 23979-41-1
English Name (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O
InChIKey CMWTZPSULFXXJA-SECBINFHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is a solid with a crystalline form. Its molecular weight...

Compound Q&A

How is (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1) typically synthesized?

(2R)-2-(6-Methoxy-2-naphthyl)propanoic acid is typically synthesized via a multi-step process involv...

Compound Q&A

What precautions should be taken when handling (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid (CAS: 23979-41-1)?

When handling (2R)-2-(6-Methoxy-2-naphthyl)propanoic acid, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...