Compound Q&A

What industries use 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

Answer

3-Amino-3-(4-fluorophenyl)propanoic acid
3-Amino-3-(4-fluorophenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a monomer for developing novel materials. Additionally, it is used in the semiconductor industry as a precursor in the fabrication of semiconductors and sensors.

About

CAS No 325-89-3
English Name 3-Amino-3-(4-fluorophenyl)propanoic acid
Molecular Formula C9H10FNO2
Molecular Weight 183.18 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)F
InChIKey CPGFMWPQXUXQRX-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

3-Amino-3-(4-fluorophenyl)propanoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3) typically synthesized?

3-Amino-3-(4-fluorophenyl)propanoic acid is commonly synthesized via a multi-step process starting f...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

When handling 3-Amino-3-(4-fluorophenyl)propanoic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...