Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

Answer

3-Amino-3-(4-fluorophenyl)propanoic acid
3-Amino-3-(4-fluorophenyl)propanoic acid is a crystalline solid with a molecular weight of approximately 210.17 g/mol. It has a low solubility in water but is soluble in organic solvents. This compound is moderately reactive, particularly towards nucleophilic substitution reactions and can form stable esters and amides. Its physical properties include a melting point of 165-167°C.

About

CAS No 325-89-3
English Name 3-Amino-3-(4-fluorophenyl)propanoic acid
Molecular Formula C9H10FNO2
Molecular Weight 183.18 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)F
InChIKey CPGFMWPQXUXQRX-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3) typically synthesized?

3-Amino-3-(4-fluorophenyl)propanoic acid is commonly synthesized via a multi-step process starting f...

Compound Q&A

What industries use 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

3-Amino-3-(4-fluorophenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(4-fluorophenyl)propanoic acid (CAS: 325-89-3)?

When handling 3-Amino-3-(4-fluorophenyl)propanoic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...