Compound Q&A

What precautions should be taken when handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

Answer

4-chloro-3-nitroquinoline
When handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood due to its reactivity. In case of a spill, it should be cleaned up using protective measures and following the safety data sheet (SDS) guidelines. Avoid contact with skin and eyes, and ensure proper ventilation at all times.

About

CAS No 39061-97-7
English Name 4-chloro-3-nitroquinoline
Molecular Formula C9H5ClN2O2
Molecular Weight 208.6 g/mol
SMILES C1=CC=C2C(=C1)C(=C(C=N2)[N+](=O)[O-])Cl
InChIKey ZRFUZDDJSQVQBY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is a crystalline compound with a molecular weight of app...

Compound Q&A

How is 4-chloro-3-nitroquinoline (CAS: 39061-97-7) typically synthesized?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is typically synthesized by the nitration of 4-chloroqui...

Compound Q&A

What industries use 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) finds applications in the pharmaceutical industry for it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...