Compound Q&A

How is 4-chloro-3-nitroquinoline (CAS: 39061-97-7) typically synthesized?

Answer

4-chloro-3-nitroquinoline
4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is typically synthesized by the nitration of 4-chloroquinoline in the presence of concentrated sulfuric acid as a catalyst. The nitro group is introduced at the 3-position, and the reaction is carried out at a controlled temperature to achieve high yield and selectivity.

About

CAS No 39061-97-7
English Name 4-chloro-3-nitroquinoline
Molecular Formula C9H5ClN2O2
Molecular Weight 208.6 g/mol
SMILES C1=CC=C2C(=C1)C(=C(C=N2)[N+](=O)[O-])Cl
InChIKey ZRFUZDDJSQVQBY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) finds applications in the pharmaceutical industry for it...

Compound Q&A

What precautions should be taken when handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

When handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...