Compound Q&A

What are the physical and chemical properties of 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

Answer

4-chloro-3-nitroquinoline
4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is a crystalline compound with a molecular weight of approximately 220.55 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive towards nucleophiles and can undergo substitution reactions. It is also known for its strong reactivity towards reducing agents.

About

CAS No 39061-97-7
English Name 4-chloro-3-nitroquinoline
Molecular Formula C9H5ClN2O2
Molecular Weight 208.6 g/mol
SMILES C1=CC=C2C(=C1)C(=C(C=N2)[N+](=O)[O-])Cl
InChIKey ZRFUZDDJSQVQBY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 4-chloro-3-nitroquinoline (CAS: 39061-97-7) typically synthesized?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is typically synthesized by the nitration of 4-chloroqui...

Compound Q&A

What industries use 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) finds applications in the pharmaceutical industry for it...

Compound Q&A

What precautions should be taken when handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

When handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...