Compound Q&A

What industries use 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

Answer

4-chloro-3-nitroquinoline
4-Chloro-3-nitroquinoline (CAS: 39061-97-7) finds applications in the pharmaceutical industry for its use as an intermediate in the synthesis of various medicinal compounds. It is also utilized in the semiconductor industry for its photochemical properties and in the polymer industry forits potential as a dopant material.

About

CAS No 39061-97-7
English Name 4-chloro-3-nitroquinoline
Molecular Formula C9H5ClN2O2
Molecular Weight 208.6 g/mol
SMILES C1=CC=C2C(=C1)C(=C(C=N2)[N+](=O)[O-])Cl
InChIKey ZRFUZDDJSQVQBY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is a crystalline compound with a molecular weight of app...

Compound Q&A

How is 4-chloro-3-nitroquinoline (CAS: 39061-97-7) typically synthesized?

4-Chloro-3-nitroquinoline (CAS: 39061-97-7) is typically synthesized by the nitration of 4-chloroqui...

Compound Q&A

What precautions should be taken when handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7)?

When handling 4-chloro-3-nitroquinoline (CAS: 39061-97-7), it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...