Compound Q&A

What precautions should be taken when handling 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

Answer

4-(4-Morpholinyl)benzoic acid
When handling 4-(4-Morpholinyl)benzoic acid, ensure the use of personal protective equipment such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be contained and cleaned up using appropriate absorbents. Refer to the safety data sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 7470-38-4
English Name 4-(4-Morpholinyl)benzoic acid
Molecular Formula C11H13NO3
Molecular Weight 207.23 g/mol
SMILES C1COCCN1C2=CC=C(C=C2)C(=O)O
InChIKey XVAJKPNTGSKZSQ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

4-(4-Morpholinyl)benzoic acid is a crystalline solid with a molecular weight of approximately 233.29...

Compound Q&A

How is 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4) typically synthesized?

4-(4-Morpholinyl)benzoic acid is typically synthesized by the condensation of 4-morpholinoaniline wi...

Compound Q&A

What industries use 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

4-(4-Morpholinyl)benzoic acid is used in various industries. It serves as a key intermediate in the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...