Compound Q&A

How is 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4) typically synthesized?

Answer

4-(4-Morpholinyl)benzoic acid
4-(4-Morpholinyl)benzoic acid is typically synthesized by the condensation of 4-morpholinoaniline with benzoic anhydride in the presence of a catalyst such as pyridine. The reaction mixture is heated to ensure completion, and the final product is purified by recrystallization from an appropriate solvent to obtain the crystalline form with good yield and selectivity.

About

CAS No 7470-38-4
English Name 4-(4-Morpholinyl)benzoic acid
Molecular Formula C11H13NO3
Molecular Weight 207.23 g/mol
SMILES C1COCCN1C2=CC=C(C=C2)C(=O)O
InChIKey XVAJKPNTGSKZSQ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

4-(4-Morpholinyl)benzoic acid is a crystalline solid with a molecular weight of approximately 233.29...

Compound Q&A

What industries use 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

4-(4-Morpholinyl)benzoic acid is used in various industries. It serves as a key intermediate in the ...

Compound Q&A

What precautions should be taken when handling 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

When handling 4-(4-Morpholinyl)benzoic acid, ensure the use of personal protective equipment such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...