Compound Q&A

What industries use 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

Answer

4-(4-Morpholinyl)benzoic acid
4-(4-Morpholinyl)benzoic acid is used in various industries. It serves as a key intermediate in the synthesis of pharmaceuticals, particularly in the production of certain pain relievers and anti-inflammatory drugs. It is also utilized in the preparation of polymers and in the development of sensors and materials for semiconductors.

About

CAS No 7470-38-4
English Name 4-(4-Morpholinyl)benzoic acid
Molecular Formula C11H13NO3
Molecular Weight 207.23 g/mol
SMILES C1COCCN1C2=CC=C(C=C2)C(=O)O
InChIKey XVAJKPNTGSKZSQ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

4-(4-Morpholinyl)benzoic acid is a crystalline solid with a molecular weight of approximately 233.29...

Compound Q&A

How is 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4) typically synthesized?

4-(4-Morpholinyl)benzoic acid is typically synthesized by the condensation of 4-morpholinoaniline wi...

Compound Q&A

What precautions should be taken when handling 4-(4-Morpholinyl)benzoic acid (CAS: 7470-38-4)?

When handling 4-(4-Morpholinyl)benzoic acid, ensure the use of personal protective equipment such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...