Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

Answer

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
When handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be handled carefully, and the material safety data sheet (MSDS) should be consulted for specific spill cleanup procedures. Always ensure good laboratory hygiene and proper disposal of waste according to local regulations.

About

CAS No 2465-32-9
English Name 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
Molecular Formula C39H72O5
Molecular Weight 621 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O
InChIKey DRAWQKGUORNASA-CLFAGFIQSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is a solid at room temperature with a crysta...

Compound Q&A

How is 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9) typically synthesized?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is typically synthesized through the reactio...

Compound Q&A

What industries use 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is used in various industries. In pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...