Compound Q&A

How is 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9) typically synthesized?

Answer

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is typically synthesized through the reaction of 1,3-propanediol and 9-octadecenoic acid under catalytic conditions. Common catalysts include transition metals such as palladium or nickel. The synthesis involves a condensation reaction followed by an esterification process, yielding a high yield of the desired product with good selectivity.

About

CAS No 2465-32-9
English Name 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
Molecular Formula C39H72O5
Molecular Weight 621 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O
InChIKey DRAWQKGUORNASA-CLFAGFIQSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is a solid at room temperature with a crysta...

Compound Q&A

What industries use 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is used in various industries. In pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

When handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...