Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

Answer

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is a solid at room temperature with a crystalline form. Its molecular weight is approximately 670.91 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is reactive, particularly towards nucleophiles and bases, and can undergo various types of addition and substitution reactions.

About

CAS No 2465-32-9
English Name 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
Molecular Formula C39H72O5
Molecular Weight 621 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O
InChIKey DRAWQKGUORNASA-CLFAGFIQSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9) typically synthesized?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is typically synthesized through the reactio...

Compound Q&A

What industries use 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is used in various industries. In pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

When handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...