Compound Q&A

What industries use 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

Answer

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is used in various industries. In pharmaceuticals, it serves as a precursor for drug synthesis. In polymer science, it is used to produce copolymers and block copolymers. Additionally, it finds applications in the production of sensors and semiconductors due to its unique physical and chemical properties.

About

CAS No 2465-32-9
English Name 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate)
Molecular Formula C39H72O5
Molecular Weight 621 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O
InChIKey DRAWQKGUORNASA-CLFAGFIQSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is a solid at room temperature with a crysta...

Compound Q&A

How is 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9) typically synthesized?

2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) is typically synthesized through the reactio...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) (CAS: 2465-32-9)?

When handling 2-Hydroxy-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...