Compound Q&A

What precautions should be taken when handling R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

Answer

R-(-)-Clopidogrel Hydrogen Sulfate
Handling R-(-)-Clopidogrel Hydrogen Sulfate should be done in a ventilated area, such as a fume hood, to minimize inhalation risks. Personal protective equipment (PPE) including gloves, safety glasses, and a lab coat is recommended. Spills should be cleaned up immediately using appropriate absorbents, and the area should be thoroughly washed. A safety data sheet (SDS) should be consulted before handling the compound.

About

English Name R-(-)-Clopidogrel Hydrogen Sulfate
Molecular Formula C16H18ClNO6S2
Molecular Weight 419.91 g/mol
SMILES COC(=O)[C@H](N1CCc2sccc2C1)c3ccccc3Cl.OS(=O)(=O)O
InChIKey FDEODCTUSIWGLK-XFULWGLBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

R-(-)-Clopidogrel Hydrogen Sulfate is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3) typically synthesized?

R-(-)-Clopidogrel Hydrogen Sulfate is synthesized by the stereoselective hydrogenation of clopidogre...

Compound Q&A

What industries use R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

R-(-)-Clopidogrel Hydrogen Sulfate is primarily used in the pharmaceutical industry. It is an active...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...