Compound Q&A

What are the physical and chemical properties of R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

Answer

R-(-)-Clopidogrel Hydrogen Sulfate
R-(-)-Clopidogrel Hydrogen Sulfate is a crystalline compound with a molecular weight of approximately 340.36 g/mol. It is sparingly soluble in water and alcohol but readily soluble in dilute acid. The compound is less reactive than its parent compound, clopidogrel, and is used primarily in pharmaceutical applications.

About

English Name R-(-)-Clopidogrel Hydrogen Sulfate
Molecular Formula C16H18ClNO6S2
Molecular Weight 419.91 g/mol
SMILES COC(=O)[C@H](N1CCc2sccc2C1)c3ccccc3Cl.OS(=O)(=O)O
InChIKey FDEODCTUSIWGLK-XFULWGLBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3) typically synthesized?

R-(-)-Clopidogrel Hydrogen Sulfate is synthesized by the stereoselective hydrogenation of clopidogre...

Compound Q&A

What industries use R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

R-(-)-Clopidogrel Hydrogen Sulfate is primarily used in the pharmaceutical industry. It is an active...

Compound Q&A

What precautions should be taken when handling R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

Handling R-(-)-Clopidogrel Hydrogen Sulfate should be done in a ventilated area, such as a fume hood...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...