Compound Q&A

What industries use R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

Answer

R-(-)-Clopidogrel Hydrogen Sulfate
R-(-)-Clopidogrel Hydrogen Sulfate is primarily used in the pharmaceutical industry. It is an active pharmaceutical ingredient (API) used in the formulation of antiplatelet medications, such as Plavix, to prevent thrombosis. It is not commonly used in other industries like polymers, sensors, or semiconductors.

About

English Name R-(-)-Clopidogrel Hydrogen Sulfate
Molecular Formula C16H18ClNO6S2
Molecular Weight 419.91 g/mol
SMILES COC(=O)[C@H](N1CCc2sccc2C1)c3ccccc3Cl.OS(=O)(=O)O
InChIKey FDEODCTUSIWGLK-XFULWGLBSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

R-(-)-Clopidogrel Hydrogen Sulfate is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3) typically synthesized?

R-(-)-Clopidogrel Hydrogen Sulfate is synthesized by the stereoselective hydrogenation of clopidogre...

Compound Q&A

What precautions should be taken when handling R-(-)-Clopidogrel Hydrogen Sulfate (CAS: 120202-71-3)?

Handling R-(-)-Clopidogrel Hydrogen Sulfate should be done in a ventilated area, such as a fume hood...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...