Compound Q&A

What precautions should be taken when handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

Answer

6-Bromo-4-nitro-1H-indazole
When handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7), it is essential to use personal protective equipment (PPE) including safety goggles, gloves, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name 6-Bromo-4-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])Br
InChIKey AHEMYGJJCOXPSP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) typically synthesized?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is typically synthesized through nitration of indazol...

Compound Q&A

What industries use 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is primarily used in the pharmaceutical and chemical ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...