Compound Q&A

How is 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) typically synthesized?

Answer

6-Bromo-4-nitro-1H-indazole
6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is typically synthesized through nitration of indazole followed by bromination. Common methods involve using concentrated nitric acid (HNO3) and sulfuric acid (H2SO4) as the nitration reagents, followed by bromination using bromine (Br2) in the presence of a base like potassium hydroxide (KOH). The reaction is carried out under carefully controlled conditions to achieve high yield and selectivity.

About

English Name 6-Bromo-4-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])Br
InChIKey AHEMYGJJCOXPSP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is primarily used in the pharmaceutical and chemical ...

Compound Q&A

What precautions should be taken when handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

When handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7), it is essential to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...