Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

Answer

6-Bromo-4-nitro-1H-indazole
6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is a crystalline solid with a molecular weight of approximately 267.04 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. The compound is known for its high reactivity, particularly with reducing agents and nucleophiles. It exhibits typical amphoteric behavior, reacting both as an acid and a base under certain conditions.

About

English Name 6-Bromo-4-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])Br
InChIKey AHEMYGJJCOXPSP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) typically synthesized?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is typically synthesized through nitration of indazol...

Compound Q&A

What industries use 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is primarily used in the pharmaceutical and chemical ...

Compound Q&A

What precautions should be taken when handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

When handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7), it is essential to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...