Compound Q&A

What industries use 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

Answer

6-Bromo-4-nitro-1H-indazole
6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various medicinal compounds, particularly those involving aromatic substitution reactions. Its applications include the development of new drugs, sensors, and materials for electronic devices.

About

English Name 6-Bromo-4-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])Br
InChIKey AHEMYGJJCOXPSP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) typically synthesized?

6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7) is typically synthesized through nitration of indazol...

Compound Q&A

What precautions should be taken when handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7)?

When handling 6-Bromo-4-nitro-1H-indazole (CAS: 885518-46-7), it is essential to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...