Compound Q&A

What precautions should be taken when handling Isosilybin B (CAS: 142796-22-3)?

Answer

Isosilybin B
When handling Isosilybin B (CAS: 142796-22-3), it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Store the compound in a cool, dry place away from direct sunlight. Use fume hoods during handling to minimize exposure to vapors. In case of a spill, clean up immediately using appropriate absorbent materials and follow local laboratory safety guidelines. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Isosilybin B
Molecular Formula C25H22O10
Molecular Weight 482.44 g/mol
SMILES COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=CC(=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O
InChIKey FDQAOULAVFHKBX-WAABAYLZSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is a crystalline compound with a molecular weight of approximately 4...

Compound Q&A

How is Isosilybin B (CAS: 142796-22-3) typically synthesized?

Isosilybin B (CAS: 142796-22-3) can be synthesized through a series of reactions involving silybin a...

Compound Q&A

What industries use Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is primarily used in the pharmaceutical industry for its potential h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...