Compound Q&A

How is Isosilybin B (CAS: 142796-22-3) typically synthesized?

Answer

Isosilybin B
Isosilybin B (CAS: 142796-22-3) can be synthesized through a series of reactions involving silybin and subsequent modifications. Common synthesis methods include enzymatic transformations and chemical derivatizations. The process typically involves the use of mild organic solvents and requires careful control of reaction conditions to achieve high selectivity and yield.

About

English Name Isosilybin B
Molecular Formula C25H22O10
Molecular Weight 482.44 g/mol
SMILES COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=CC(=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O
InChIKey FDQAOULAVFHKBX-WAABAYLZSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is a crystalline compound with a molecular weight of approximately 4...

Compound Q&A

What industries use Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is primarily used in the pharmaceutical industry for its potential h...

Compound Q&A

What precautions should be taken when handling Isosilybin B (CAS: 142796-22-3)?

When handling Isosilybin B (CAS: 142796-22-3), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...