Compound Q&A

What are the physical and chemical properties of Isosilybin B (CAS: 142796-22-3)?

Answer

Isosilybin B
Isosilybin B (CAS: 142796-22-3) is a crystalline compound with a molecular weight of approximately 436.38 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. Isosilybin B exhibits moderate reactivity, particularly towards acidic conditions. It is often used in the pharmaceutical industry for its antioxidant and anti-inflammatory properties.

About

English Name Isosilybin B
Molecular Formula C25H22O10
Molecular Weight 482.44 g/mol
SMILES COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=CC(=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O
InChIKey FDQAOULAVFHKBX-WAABAYLZSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Isosilybin B (CAS: 142796-22-3) typically synthesized?

Isosilybin B (CAS: 142796-22-3) can be synthesized through a series of reactions involving silybin a...

Compound Q&A

What industries use Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is primarily used in the pharmaceutical industry for its potential h...

Compound Q&A

What precautions should be taken when handling Isosilybin B (CAS: 142796-22-3)?

When handling Isosilybin B (CAS: 142796-22-3), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...