Compound Q&A

What industries use Isosilybin B (CAS: 142796-22-3)?

Answer

Isosilybin B
Isosilybin B (CAS: 142796-22-3) is primarily used in the pharmaceutical industry for its potential health benefits. It is also explored in the food industry as a natural antioxidant and in the cosmetics industry for its skin conditioning properties. Additionally, its antioxidant properties make it applicable in the polymer industry for improving the stability of polymer products.

About

English Name Isosilybin B
Molecular Formula C25H22O10
Molecular Weight 482.44 g/mol
SMILES COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=CC(=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O
InChIKey FDQAOULAVFHKBX-WAABAYLZSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isosilybin B (CAS: 142796-22-3)?

Isosilybin B (CAS: 142796-22-3) is a crystalline compound with a molecular weight of approximately 4...

Compound Q&A

How is Isosilybin B (CAS: 142796-22-3) typically synthesized?

Isosilybin B (CAS: 142796-22-3) can be synthesized through a series of reactions involving silybin a...

Compound Q&A

What precautions should be taken when handling Isosilybin B (CAS: 142796-22-3)?

When handling Isosilybin B (CAS: 142796-22-3), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...