Compound Q&A

What industries use Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Answer

Methyl 2,6-difluoro-3-nitrobenzoate
Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It also finds applications in the production of certain polymers and in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 84832-01-9
English Name Methyl 2,6-difluoro-3-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)c1c(F)ccc([N+](=O)[O-])c1F
InChIKey CIHHBTMZOLRCRL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is a crystalline solid with a molecular weight...

Compound Q&A

How is Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) typically synthesized?

Methyl 2,6-difluoro-3-nitrobenzoate can be synthesized through the nitration of 2,6-difluorobenzoic ...

Compound Q&A

What precautions should be taken when handling Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Proper personal protective equipment (PPE) should always be worn when handling Methyl 2,6-difluoro-3...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...