Compound Q&A

What are the physical and chemical properties of Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Answer

Methyl 2,6-difluoro-3-nitrobenzoate
Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is a crystalline solid with a molecular weight of approximately 237.07 g/mol. It has a low solubility in water but is more soluble in common organic solvents such as ethanol and acetone. The compound is moderately reactive, particularly with reducing agents and bases. It has a pKa of around 2.5, indicating its acidic nature.

About

CAS No 84832-01-9
English Name Methyl 2,6-difluoro-3-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)c1c(F)ccc([N+](=O)[O-])c1F
InChIKey CIHHBTMZOLRCRL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) typically synthesized?

Methyl 2,6-difluoro-3-nitrobenzoate can be synthesized through the nitration of 2,6-difluorobenzoic ...

Compound Q&A

What industries use Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Proper personal protective equipment (PPE) should always be worn when handling Methyl 2,6-difluoro-3...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...