Compound Q&A

How is Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) typically synthesized?

Answer

Methyl 2,6-difluoro-3-nitrobenzoate
Methyl 2,6-difluoro-3-nitrobenzoate can be synthesized through the nitration of 2,6-difluorobenzoic acid followed by esterification with methanol. Commonly, this process involves the use of nitric acid and sulfuric acid as the nitrating mixture, with precise temperature control to ensure the desired product is formed with high selectivity and yield. Post-synthesis, the product is typically purified by recrystallization.

About

CAS No 84832-01-9
English Name Methyl 2,6-difluoro-3-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)c1c(F)ccc([N+](=O)[O-])c1F
InChIKey CIHHBTMZOLRCRL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is a crystalline solid with a molecular weight...

Compound Q&A

What industries use Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling Methyl 2,6-difluoro-3-nitrobenzoate (CAS: 84832-01-9)?

Proper personal protective equipment (PPE) should always be worn when handling Methyl 2,6-difluoro-3...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...