Compound Q&A

What precautions should be taken when handling (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

Answer

(4-Chloro-3-methoxyphenyl)boronic acid
Handling (4-Chloro-3-methoxyphenyl)boronic acid should be done with appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Ensure that all operations are conducted in a fume hood to minimize exposure to fumes. Spills should be carefully cleaned up using absorbent materials and appropriate waste handling procedures as per the safety data sheet (SDS). Always refer to the latest SDS for specific safety guidelines and emergency procedures.

About

CAS No 89694-47-3
English Name (4-Chloro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BClO3
Molecular Weight 186.4 g/mol
SMILES B(C1=CC(=C(C=C1)Cl)OC)(O)O
InChIKey DZNNRXURZJLARZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

(4-Chloro-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3) typically synthesized?

(4-Chloro-3-methoxyphenyl)boronic acid is commonly synthesized through the coupling of 4-chloro-3-me...

Compound Q&A

What industries use (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

(4-Chloro-3-methoxyphenyl)boronic acid is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...