Compound Q&A

What are the physical and chemical properties of (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

Answer

(4-Chloro-3-methoxyphenyl)boronic acid
(4-Chloro-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of approximately 228.04 g/mol. It is slightly soluble in water and ethanol. This compound displays good reactivity in boronate ester formation and is used as a boronic acid building block in organic synthesis. Its solubility and reactivity make it a valuable reagent in various chemical processes.

About

CAS No 89694-47-3
English Name (4-Chloro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BClO3
Molecular Weight 186.4 g/mol
SMILES B(C1=CC(=C(C=C1)Cl)OC)(O)O
InChIKey DZNNRXURZJLARZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3) typically synthesized?

(4-Chloro-3-methoxyphenyl)boronic acid is commonly synthesized through the coupling of 4-chloro-3-me...

Compound Q&A

What industries use (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

(4-Chloro-3-methoxyphenyl)boronic acid is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

Handling (4-Chloro-3-methoxyphenyl)boronic acid should be done with appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...