Compound Q&A

What industries use (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

Answer

(4-Chloro-3-methoxyphenyl)boronic acid
(4-Chloro-3-methoxyphenyl)boronic acid is primarily used in the pharmaceutical industry for the synthesis of new drugs and intermediates. It is also utilized in the polymer industry for the development of advanced materials. Additionally, this compound can be applied in sensor technology and semiconductor manufacturing due to its unique chemical properties.

About

CAS No 89694-47-3
English Name (4-Chloro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BClO3
Molecular Weight 186.4 g/mol
SMILES B(C1=CC(=C(C=C1)Cl)OC)(O)O
InChIKey DZNNRXURZJLARZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

(4-Chloro-3-methoxyphenyl)boronic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3) typically synthesized?

(4-Chloro-3-methoxyphenyl)boronic acid is commonly synthesized through the coupling of 4-chloro-3-me...

Compound Q&A

What precautions should be taken when handling (4-Chloro-3-methoxyphenyl)boronic acid (CAS: 89694-47-3)?

Handling (4-Chloro-3-methoxyphenyl)boronic acid should be done with appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...