Compound Q&A

What precautions should be taken when handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

Answer

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
When handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a well-ventilated area and handled in a fume hood to minimize exposure. Spills should be immediately cleaned up with appropriate absorbent materials, and the area should be flushed with water. This compound should be managed according to the material safety data sheet (MSDS) and local regulations for hazardous materials.

About

English Name {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
Molecular Formula C15H13ClFNO2
Molecular Weight 293.73 g/mol
SMILES CC1=CC(=C(C=C1)NC2=C(C=CC=C2Cl)F)CC(=O)O
InChIKey KHPKQFYUPIUARC-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is a solid compound with a molecular ...

Compound Q&A

How is {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8) typically synthesized?

The synthesis of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is typically achieve...

Compound Q&A

What industries use {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid finds applications in the pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...