Compound Q&A

What are the physical and chemical properties of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

Answer

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is a solid compound with a molecular weight of approximately 344.68 g/mol. It is sparingly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound is known for its high reactivity, particularly in esterification reactions and nucleophilic substitution. It has a melting point around 220-225°C and is stable under normal conditions but should be stored in a dry environment to prevent hydrolysis.

About

English Name {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
Molecular Formula C15H13ClFNO2
Molecular Weight 293.73 g/mol
SMILES CC1=CC(=C(C=C1)NC2=C(C=CC=C2Cl)F)CC(=O)O
InChIKey KHPKQFYUPIUARC-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8) typically synthesized?

The synthesis of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is typically achieve...

Compound Q&A

What industries use {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid finds applications in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

When handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid, it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...