Compound Q&A

What industries use {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

Answer

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid finds applications in the pharmaceutical industry where it serves as an intermediate for the synthesis of various drugs. It is also used in the sensor industry due to its specific reactivity and in the semiconductor industry for its potential role in organic electronics. Additionally, it is explored in the polymer industry for its properties in modifying the functionality of polymers.

About

English Name {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
Molecular Formula C15H13ClFNO2
Molecular Weight 293.73 g/mol
SMILES CC1=CC(=C(C=C1)NC2=C(C=CC=C2Cl)F)CC(=O)O
InChIKey KHPKQFYUPIUARC-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

{2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is a solid compound with a molecular ...

Compound Q&A

How is {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8) typically synthesized?

The synthesis of {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid is typically achieve...

Compound Q&A

What precautions should be taken when handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid (CAS: 220991-20-8)?

When handling {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid, it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...