Compound Q&A

What precautions should be taken when handling 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

Answer

2,3-Difluoro-6-methoxybenzoic acid
When handling 2,3-Difluoro-6-methoxybenzoic acid, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 2,3-Difluoro-6-methoxybenzoic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES COC1=C(C(=C(C=C1)F)F)C(=O)O
InChIKey MMTKYWQMCSZCGW-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0) typically synthesized?

2,3-Difluoro-6-methoxybenzoic acid can be synthesized by the reaction of 4-chloro-6-methoxybenzoic a...

Compound Q&A

What industries use 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is primarily used in the pharmaceutical industry as an intermedia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...