Compound Q&A

How is 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0) typically synthesized?

Answer

2,3-Difluoro-6-methoxybenzoic acid
2,3-Difluoro-6-methoxybenzoic acid can be synthesized by the reaction of 4-chloro-6-methoxybenzoic acid with potassium fluoride in the presence of a base such as potassium tert-butoxide. The reaction proceeds via a nucleophilic substitution, where the chlorine atom is replaced by a difluoro group. This method provides good yield and selectivity. Other methods involve the modification of 2,3-difluorobenzoic acid with methoxy groups.

About

English Name 2,3-Difluoro-6-methoxybenzoic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES COC1=C(C(=C(C=C1)F)F)C(=O)O
InChIKey MMTKYWQMCSZCGW-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is primarily used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

When handling 2,3-Difluoro-6-methoxybenzoic acid, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...