Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

Answer

2,3-Difluoro-6-methoxybenzoic acid
2,3-Difluoro-6-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 206.06 g/mol. It has a low water solubility (0.025 g/L at 25°C) and is slightly soluble in common organic solvents such as ethanol and acetone. The compound is relatively stable under normal conditions but can undergo hydrolysis under acidic conditions. It is generally reactive towards nucleophiles and can be used in organic synthesis as a functionalized aromatic acid.

About

English Name 2,3-Difluoro-6-methoxybenzoic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES COC1=C(C(=C(C=C1)F)F)C(=O)O
InChIKey MMTKYWQMCSZCGW-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0) typically synthesized?

2,3-Difluoro-6-methoxybenzoic acid can be synthesized by the reaction of 4-chloro-6-methoxybenzoic a...

Compound Q&A

What industries use 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is primarily used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

When handling 2,3-Difluoro-6-methoxybenzoic acid, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...