Compound Q&A

What industries use 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

Answer

2,3-Difluoro-6-methoxybenzoic acid
2,3-Difluoro-6-methoxybenzoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also employed in the polymer industry for the development of novel polymers with specific properties. Additionally, it finds applications in the production of sensors and in semiconductor technology due to its unique chemical structure.

About

English Name 2,3-Difluoro-6-methoxybenzoic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES COC1=C(C(=C(C=C1)F)F)C(=O)O
InChIKey MMTKYWQMCSZCGW-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

2,3-Difluoro-6-methoxybenzoic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0) typically synthesized?

2,3-Difluoro-6-methoxybenzoic acid can be synthesized by the reaction of 4-chloro-6-methoxybenzoic a...

Compound Q&A

What precautions should be taken when handling 2,3-Difluoro-6-methoxybenzoic acid (CAS: 773873-26-0)?

When handling 2,3-Difluoro-6-methoxybenzoic acid, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...